C18H13N3O2 — CID 10266957
benzyl 9H-pyridazino[3,4-b]indole-3-carboxylate (PubChem CID 10266957) has the molecular formula C18H13N3O2 and a molecular weight of 303.32 g/mol. Its IUPAC name is benzyl 9H-pyridazino[3,4-b]indole-3-carboxylate.
| Compound Name | benzyl 9H-pyridazino[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 10266957 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | benzyl 9H-pyridazino[3,4-b]indole-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1cc2c(nn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C18H13N3O2/c22-18(23-11-12-6-2-1-3-7-12)16-10-14-13-8-4-5-9-15(13)19-17(14)21-20-16/h1-10H,11H2,(H,19,21) |
| InChIKey | GFSUAESFZBNXQJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |