C13H12N2O4 — CID 91757662
3-O-benzyl 5-O-methyl 1H-pyrazole-3,5-dicarboxylate (PubChem CID 91757662) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3-O-benzyl 5-O-methyl 1H-pyrazole-3,5-dicarboxylate.
| Compound Name | 3-O-benzyl 5-O-methyl 1H-pyrazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 91757662 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3-O-benzyl 5-O-methyl 1H-pyrazole-3,5-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OCc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C13H12N2O4/c1-18-12(16)10-7-11(15-14-10)13(17)19-8-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,14,15) |
| InChIKey | IGIULYFGUNOFPG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |