C15H14N2O5S — CID 135436062
methyl 6-oxo-2-(2-oxo-2-phenylmethoxyethyl)sulfanyl-1H-pyrimidine-4-carboxylate (PubChem CID 135436062) has the molecular formula C15H14N2O5S and a molecular weight of 334.35 g/mol. Its IUPAC name is methyl 6-oxo-2-(2-oxo-2-phenylmethoxyethyl)sulfanyl-1H-pyrimidine-4-carboxylate.
| Compound Name | methyl 6-oxo-2-(2-oxo-2-phenylmethoxyethyl)sulfanyl-1H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 135436062 |
| Molecular Formula | C15H14N2O5S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | methyl 6-oxo-2-(2-oxo-2-phenylmethoxyethyl)sulfanyl-1H-pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1cc(=O)[nH]c(SCC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C15H14N2O5S/c1-21-14(20)11-7-12(18)17-15(16-11)23-9-13(19)22-8-10-5-3-2-4-6-10/h2-7H,8-9H2,1H3,(H,16,17,18) |
| InChIKey | GEAVPGYCNCIOJM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |