C16H17N3O4S — CID 135561440
ethyl 2-[[2-[(6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]acetate (PubChem CID 135561440) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is ethyl 2-[[2-[(6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[(6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 135561440 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | ethyl 2-[[2-[(6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)CSc1nc(-c2ccccc2)cc(=O)[nH]1 |
| InChI | InChI=1S/C16H17N3O4S/c1-2-23-15(22)9-17-14(21)10-24-16-18-12(8-13(20)19-16)11-6-4-3-5-7-11/h3-8H,2,9-10H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | WKQKKZLCKAHNDD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |