About methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate
methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate (PubChem CID 59926336) has the molecular formula C17H15N3O4
and a molecular weight of 325.32 g/mol. Its IUPAC name is methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate |
| PubChem CID | 59926336 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate |
| SMILES | COC(=O)c1cc2c(=O)n(Cc3ccccc3)c(=O)n(C)c2cn1 |
| InChI | InChI=1S/C17H15N3O4/c1-19-14-9-18-13(16(22)24-2)8-12(14)15(21)20(17(19)23)10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3 |
| InChIKey | KHHFXJNXKUSIRD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate?
The IUPAC name of methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate (CID 59926336) is methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate.
What is the SMILES notation for methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate?
The canonical SMILES for methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate is COC(=O)c1cc2c(=O)n(Cc3ccccc3)c(=O)n(C)c2cn1.
What is the InChIKey of methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate?
The InChIKey is KHHFXJNXKUSIRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O4/c1-19-14-9-18-13(16(22)24-2)8-12(14)15(21)20(17(19)23)10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3.
What are the key properties of methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate?
methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate has a molecular weight of 325.32 g/mol, XLogP of 0.93, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-benzyl-1-methyl-2,4-dioxopyrido[3,4-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 59926336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).