C22H19ClF3N3O — CID 171925994
1-[(4-aminophenyl)methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]benzimidazol-2-one;hydrochloride (PubChem CID 171925994) has the molecular formula C22H19ClF3N3O and a molecular weight of 433.86 g/mol. Its IUPAC name is 1-[(4-aminophenyl)methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]benzimidazol-2-one;hydrochloride.
| Compound Name | 1-[(4-aminophenyl)methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]benzimidazol-2-one;hydrochloride |
|---|---|
| PubChem CID | 171925994 |
| Molecular Formula | C22H19ClF3N3O |
| Molecular Weight | 433.86 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1-[(4-aminophenyl)methyl]-3-[[4-(trifluoromethyl)phenyl]methyl]benzimidazol-2-one;hydrochloride |
| SMILES | Cl.Nc1ccc(Cn2c(=O)n(Cc3ccc(C(F)(F)F)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H18F3N3O.ClH/c23-22(24,25)17-9-5-15(6-10-17)13-27-19-3-1-2-4-20(19)28(21(27)29)14-16-7-11-18(26)12-8-16;/h1-12H,13-14,26H2;1H |
| InChIKey | LKHPFCPWAZZENC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.86 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|