C15H10F3NO2 — CID 2744505
3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-benzoxazol-2-one (PubChem CID 2744505) has the molecular formula C15H10F3NO2 and a molecular weight of 293.24 g/mol. Its IUPAC name is 3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 2744505 |
| Molecular Formula | C15H10F3NO2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-[[4-(trifluoromethyl)phenyl]methyl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F3NO2/c16-15(17,18)11-7-5-10(6-8-11)9-19-12-3-1-2-4-13(12)21-14(19)20/h1-8H,9H2 |
| InChIKey | AKDNRCALWKIADT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |