C33H23F3N4O3 — CID 126292046
3-[[2-methyl-3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]indol-1-yl]methyl]benzoic acid (PubChem CID 126292046) has the molecular formula C33H23F3N4O3 and a molecular weight of 580.57 g/mol. Its IUPAC name is 3-[[2-methyl-3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[2-methyl-3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 126292046 |
| Molecular Formula | C33H23F3N4O3 |
| Molecular Weight | 580.57 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | 3-[[2-methyl-3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]indol-1-yl]methyl]benzoic acid |
| SMILES | Cc1c(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c2ccccc2n1Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C33H23F3N4O3/c1-20-27(25-12-3-5-15-29(25)39(20)19-21-8-6-10-23(16-21)32(42)43)18-37-40-30(22-9-7-11-24(17-22)33(34,35)36)38-28-14-4-2-13-26(28)31(40)41/h2-18H,19H2,1H3,(H,42,43) |
| InChIKey | PCUBQGUKUQJACP-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.57 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|