C34H23ClN4O4 — CID 126301800
4-[[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methylindol-1-yl]methyl]benzoic acid (PubChem CID 126301800) has the molecular formula C34H23ClN4O4 and a molecular weight of 587.04 g/mol. Its IUPAC name is 4-[[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methylindol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methylindol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 126301800 |
| Molecular Formula | C34H23ClN4O4 |
| Molecular Weight | 587.04 g/mol |
| Exact Mass | 586.14 |
| IUPAC Name | 4-[[3-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methylindol-1-yl]methyl]benzoic acid |
| SMILES | Cc1c(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)c2ccccc2n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C34H23ClN4O4/c1-20-27(25-6-3-5-9-29(25)38(20)19-21-10-12-22(13-11-21)34(41)42)18-36-39-32(37-28-8-4-2-7-26(28)33(39)40)31-17-23-16-24(35)14-15-30(23)43-31/h2-18H,19H2,1H3,(H,41,42) |
| InChIKey | FVRBPFBJVYHZEA-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.04 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|