C32H30N4O3 — CID 126309921
4-[[3-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]methyl]benzoic acid (PubChem CID 126309921) has the molecular formula C32H30N4O3 and a molecular weight of 518.62 g/mol. Its IUPAC name is 4-[[3-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[3-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 126309921 |
| Molecular Formula | C32H30N4O3 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 4-[[3-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]methyl]benzoic acid |
| SMILES | Cc1c(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c2ccccc2n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H30N4O3/c1-21-27(25-11-6-8-14-29(25)35(21)20-22-15-17-24(18-16-22)32(38)39)19-33-36-30(23-9-3-2-4-10-23)34-28-13-7-5-12-26(28)31(36)37/h5-8,11-19,23H,2-4,9-10,20H2,1H3,(H,38,39) |
| InChIKey | JSNSMSHNMBOONM-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|