C32H32N4O — CID 126291997
2-cyclohexyl-3-[[2-methyl-1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126291997) has the molecular formula C32H32N4O and a molecular weight of 488.64 g/mol. Its IUPAC name is 2-cyclohexyl-3-[[2-methyl-1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[[2-methyl-1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126291997 |
| Molecular Formula | C32H32N4O |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 2-cyclohexyl-3-[[2-methyl-1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1cccc(Cn2c(C)c(C=Nn3c(C4CCCCC4)nc4ccccc4c3=O)c3ccccc32)c1 |
| InChI | InChI=1S/C32H32N4O/c1-22-11-10-12-24(19-22)21-35-23(2)28(26-15-7-9-18-30(26)35)20-33-36-31(25-13-4-3-5-14-25)34-29-17-8-6-16-27(29)32(36)37/h6-12,15-20,25H,3-5,13-14,21H2,1-2H3 |
| InChIKey | OVCHDXRHRLMPIE-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|