C26H26N4O3 — CID 126296511
2-[3-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]acetic acid (PubChem CID 126296511) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[3-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 126296511 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-[3-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c2ccccc2n1CC(=O)O |
| InChI | InChI=1S/C26H26N4O3/c1-17-21(19-11-6-8-14-23(19)29(17)16-24(31)32)15-27-30-25(18-9-3-2-4-10-18)28-22-13-7-5-12-20(22)26(30)33/h5-8,11-15,18H,2-4,9-10,16H2,1H3,(H,31,32) |
| InChIKey | SHSMMSQOWGTEQK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|