C23H21I2N3O4 — CID 126288723
2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-diiodophenoxy]acetic acid (PubChem CID 126288723) has the molecular formula C23H21I2N3O4 and a molecular weight of 657.25 g/mol. Its IUPAC name is 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-diiodophenoxy]acetic acid.
| Compound Name | 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-diiodophenoxy]acetic acid |
|---|---|
| PubChem CID | 126288723 |
| Molecular Formula | C23H21I2N3O4 |
| Molecular Weight | 657.25 g/mol |
| Exact Mass | 656.96 |
| IUPAC Name | 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-diiodophenoxy]acetic acid |
| SMILES | O=C(O)COc1c(I)cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc1I |
| InChI | InChI=1S/C23H21I2N3O4/c24-17-10-14(11-18(25)21(17)32-13-20(29)30)12-26-28-22(15-6-2-1-3-7-15)27-19-9-5-4-8-16(19)23(28)31/h4-5,8-12,15H,1-3,6-7,13H2,(H,29,30) |
| InChIKey | HISCAJFSCGQAGU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.25 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|