C26H30IN3O2 — CID 126293081
2-cyclohexyl-3-[[4-(2,2-dimethylpropoxy)-3-iodophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126293081) has the molecular formula C26H30IN3O2 and a molecular weight of 543.45 g/mol. Its IUPAC name is 2-cyclohexyl-3-[[4-(2,2-dimethylpropoxy)-3-iodophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[[4-(2,2-dimethylpropoxy)-3-iodophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126293081 |
| Molecular Formula | C26H30IN3O2 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 2-cyclohexyl-3-[[4-(2,2-dimethylpropoxy)-3-iodophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC(C)(C)COc1ccc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc1I |
| InChI | InChI=1S/C26H30IN3O2/c1-26(2,3)17-32-23-14-13-18(15-21(23)27)16-28-30-24(19-9-5-4-6-10-19)29-22-12-8-7-11-20(22)25(30)31/h7-8,11-16,19H,4-6,9-10,17H2,1-3H3 |
| InChIKey | XLNRBXAPTVCKII-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|