C26H27I2N3O4 — CID 126305846
propan-2-yl 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-diiodophenoxy]acetate (PubChem CID 126305846) has the molecular formula C26H27I2N3O4 and a molecular weight of 699.33 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-diiodophenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-diiodophenoxy]acetate |
|---|---|
| PubChem CID | 126305846 |
| Molecular Formula | C26H27I2N3O4 |
| Molecular Weight | 699.33 g/mol |
| Exact Mass | 699.01 |
| IUPAC Name | propan-2-yl 2-[4-[(2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,6-diiodophenoxy]acetate |
| SMILES | CC(C)OC(=O)COc1c(I)cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)cc1I |
| InChI | InChI=1S/C26H27I2N3O4/c1-16(2)35-23(32)15-34-24-20(27)12-17(13-21(24)28)14-29-31-25(18-8-4-3-5-9-18)30-22-11-7-6-10-19(22)26(31)33/h6-7,10-14,16,18H,3-5,8-9,15H2,1-2H3 |
| InChIKey | RPAUFPXPGVGMJU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.33 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|