C32H31BrN4O — CID 126326344
6-bromo-2-cyclohexyl-3-[[2-methyl-1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126326344) has the molecular formula C32H31BrN4O and a molecular weight of 567.53 g/mol. Its IUPAC name is 6-bromo-2-cyclohexyl-3-[[2-methyl-1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-cyclohexyl-3-[[2-methyl-1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126326344 |
| Molecular Formula | C32H31BrN4O |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 6-bromo-2-cyclohexyl-3-[[2-methyl-1-[(3-methylphenyl)methyl]indol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1cccc(Cn2c(C)c(C=Nn3c(C4CCCCC4)nc4ccc(Br)cc4c3=O)c3ccccc32)c1 |
| InChI | InChI=1S/C32H31BrN4O/c1-21-9-8-10-23(17-21)20-36-22(2)28(26-13-6-7-14-30(26)36)19-34-37-31(24-11-4-3-5-12-24)35-29-16-15-25(33)18-27(29)32(37)38/h6-10,13-19,24H,3-5,11-12,20H2,1-2H3 |
| InChIKey | PMVKDOLJEIHVLZ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|