C29H25F3N4O — CID 126301504
3-[[1-(2,2-dimethylpropyl)indol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126301504) has the molecular formula C29H25F3N4O and a molecular weight of 502.54 g/mol. Its IUPAC name is 3-[[1-(2,2-dimethylpropyl)indol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[1-(2,2-dimethylpropyl)indol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126301504 |
| Molecular Formula | C29H25F3N4O |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 3-[[1-(2,2-dimethylpropyl)indol-3-yl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | CC(C)(C)Cn1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C29H25F3N4O/c1-28(2,3)18-35-17-20(22-11-5-7-14-25(22)35)16-33-36-26(19-9-8-10-21(15-19)29(30,31)32)34-24-13-6-4-12-23(24)27(36)37/h4-17H,18H2,1-3H3 |
| InChIKey | DUHZWBQQARTDLX-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|