C31H22F3N3O5 — CID 126295563
3-[[2-methoxy-6-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126295563) has the molecular formula C31H22F3N3O5 and a molecular weight of 573.53 g/mol. Its IUPAC name is 3-[[2-methoxy-6-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-methoxy-6-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126295563 |
| Molecular Formula | C31H22F3N3O5 |
| Molecular Weight | 573.53 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | 3-[[2-methoxy-6-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | COc1cccc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C31H22F3N3O5/c1-41-26-14-6-10-22(27(26)42-18-19-7-4-9-21(15-19)30(39)40)17-35-37-28(20-8-5-11-23(16-20)31(32,33)34)36-25-13-3-2-12-24(25)29(37)38/h2-17H,18H2,1H3,(H,39,40) |
| InChIKey | MKKSWVYONQNEGY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|