C29H22FN3O3 — CID 126408378
3-[[2-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126408378) has the molecular formula C29H22FN3O3 and a molecular weight of 479.51 g/mol. Its IUPAC name is 3-[[2-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[2-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126408378 |
| Molecular Formula | C29H22FN3O3 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 3-[[2-[(3-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | COc1cccc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C29H22FN3O3/c1-35-26-16-8-12-22(27(26)36-19-20-9-7-13-23(30)17-20)18-31-33-28(21-10-3-2-4-11-21)32-25-15-6-5-14-24(25)29(33)34/h2-18H,19H2,1H3 |
| InChIKey | NMVNATIHYXKHDC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|