C29H20Br2FN3O3 — CID 126407831
3-[[2,3-dibromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126407831) has the molecular formula C29H20Br2FN3O3 and a molecular weight of 637.30 g/mol. Its IUPAC name is 3-[[2,3-dibromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[2,3-dibromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126407831 |
| Molecular Formula | C29H20Br2FN3O3 |
| Molecular Weight | 637.30 g/mol |
| Exact Mass | 634.99 |
| IUPAC Name | 3-[[2,3-dibromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)c(Br)c(Br)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C29H20Br2FN3O3/c1-37-24-15-20(25(30)26(31)27(24)38-17-18-11-13-21(32)14-12-18)16-33-35-28(19-7-3-2-4-8-19)34-23-10-6-5-9-22(23)29(35)36/h2-16H,17H2,1H3 |
| InChIKey | LEKIASNXLGHPNO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.30 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|