C29H23F3N4O3 — CID 126293032
ethyl 2-[2-methyl-3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]indol-1-yl]acetate (PubChem CID 126293032) has the molecular formula C29H23F3N4O3 and a molecular weight of 532.52 g/mol. Its IUPAC name is ethyl 2-[2-methyl-3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[2-methyl-3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 126293032 |
| Molecular Formula | C29H23F3N4O3 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | ethyl 2-[2-methyl-3-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)c2ccccc21 |
| InChI | InChI=1S/C29H23F3N4O3/c1-3-39-26(37)17-35-18(2)23(21-11-5-7-14-25(21)35)16-33-36-27(19-9-8-10-20(15-19)29(30,31)32)34-24-13-6-4-12-22(24)28(36)38/h4-16H,3,17H2,1-2H3 |
| InChIKey | XEMQTVJLKMATDL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 78.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|