C29H20F3N3O4 — CID 126295559
ethyl 4-[5-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]furan-2-yl]benzoate (PubChem CID 126295559) has the molecular formula C29H20F3N3O4 and a molecular weight of 531.49 g/mol. Its IUPAC name is ethyl 4-[5-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126295559 |
| Molecular Formula | C29H20F3N3O4 |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | ethyl 4-[5-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=Nn3c(-c4cccc(C(F)(F)F)c4)nc4ccccc4c3=O)o2)cc1 |
| InChI | InChI=1S/C29H20F3N3O4/c1-2-38-28(37)19-12-10-18(11-13-19)25-15-14-22(39-25)17-33-35-26(20-6-5-7-21(16-20)29(30,31)32)34-24-9-4-3-8-23(24)27(35)36/h3-17H,2H2,1H3 |
| InChIKey | MJSARFKKCNNWLP-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 86.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|