About 1-benzyl-5-bromo-2,3-dimethylindole
1-benzyl-5-bromo-2,3-dimethylindole (PubChem CID 25228820) has the molecular formula C17H16BrN
and a molecular weight of 314.23 g/mol. Its IUPAC name is 1-benzyl-5-bromo-2,3-dimethylindole.
Molecular Properties
| Compound Name | 1-benzyl-5-bromo-2,3-dimethylindole |
| PubChem CID | 25228820 |
| Molecular Formula | C17H16BrN |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 1-benzyl-5-bromo-2,3-dimethylindole |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(Br)cc12 |
| InChI | InChI=1S/C17H16BrN/c1-12-13(2)19(11-14-6-4-3-5-7-14)17-9-8-15(18)10-16(12)17/h3-10H,11H2,1-2H3 |
| InChIKey | MMICTBHPWHQZMA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-5-bromo-2,3-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5-bromo-2,3-dimethylindole?
The IUPAC name of 1-benzyl-5-bromo-2,3-dimethylindole (CID 25228820) is 1-benzyl-5-bromo-2,3-dimethylindole.
What is the SMILES notation for 1-benzyl-5-bromo-2,3-dimethylindole?
The canonical SMILES for 1-benzyl-5-bromo-2,3-dimethylindole is Cc1c(C)n(Cc2ccccc2)c2ccc(Br)cc12.
What is the InChIKey of 1-benzyl-5-bromo-2,3-dimethylindole?
The InChIKey is MMICTBHPWHQZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16BrN/c1-12-13(2)19(11-14-6-4-3-5-7-14)17-9-8-15(18)10-16(12)17/h3-10H,11H2,1-2H3.
What are the key properties of 1-benzyl-5-bromo-2,3-dimethylindole?
1-benzyl-5-bromo-2,3-dimethylindole has a molecular weight of 314.23 g/mol, XLogP of 5.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5-bromo-2,3-dimethylindole is sourced from PubChem (CID 25228820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).