C17H13ClF3NO — CID 58957271
6-chloro-2-methyl-3-[[3-(trifluoromethoxy)phenyl]methyl]-1H-indole (PubChem CID 58957271) has the molecular formula C17H13ClF3NO and a molecular weight of 339.74 g/mol. Its IUPAC name is 6-chloro-2-methyl-3-[[3-(trifluoromethoxy)phenyl]methyl]-1H-indole.
| Compound Name | 6-chloro-2-methyl-3-[[3-(trifluoromethoxy)phenyl]methyl]-1H-indole |
|---|---|
| PubChem CID | 58957271 |
| Molecular Formula | C17H13ClF3NO |
| Molecular Weight | 339.74 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 6-chloro-2-methyl-3-[[3-(trifluoromethoxy)phenyl]methyl]-1H-indole |
| SMILES | Cc1[nH]c2cc(Cl)ccc2c1Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H13ClF3NO/c1-10-15(14-6-5-12(18)9-16(14)22-10)8-11-3-2-4-13(7-11)23-17(19,20)21/h2-7,9,22H,8H2,1H3 |
| InChIKey | SZDHSNPCUKGZDH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.74 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|