C19H19F4N2O+ — CID 4173618
(3-fluorophenyl)methyl-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]azanium (PubChem CID 4173618) has the molecular formula C19H19F4N2O+ and a molecular weight of 367.37 g/mol. Its IUPAC name is (3-fluorophenyl)methyl-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]azanium.
| Compound Name | (3-fluorophenyl)methyl-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]azanium |
|---|---|
| PubChem CID | 4173618 |
| Molecular Formula | C19H19F4N2O+ |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (3-fluorophenyl)methyl-[2-[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]ethyl]azanium |
| SMILES | Cc1[nH]c2ccc(OC(F)(F)F)cc2c1CC[NH2+]Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H18F4N2O/c1-12-16(7-8-24-11-13-3-2-4-14(20)9-13)17-10-15(26-19(21,22)23)5-6-18(17)25-12/h2-6,9-10,24-25H,7-8,11H2,1H3/p+1 |
| InChIKey | ABRQTXWJOXUPCQ-UHFFFAOYSA-O |
| XLogP | 3.82 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|