C23H31ClN2O — CID 21313373
N-benzyl-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine;hydrochloride (PubChem CID 21313373) has the molecular formula C23H31ClN2O and a molecular weight of 386.97 g/mol. Its IUPAC name is N-benzyl-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine;hydrochloride.
| Compound Name | N-benzyl-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 21313373 |
| Molecular Formula | C23H31ClN2O |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-benzyl-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]-2-methylpropan-2-amine;hydrochloride |
| SMILES | COc1ccc2[nH]c(C)c(CCN(Cc3ccccc3)C(C)(C)C)c2c1.Cl |
| InChI | InChI=1S/C23H30N2O.ClH/c1-17-20(21-15-19(26-5)11-12-22(21)24-17)13-14-25(23(2,3)4)16-18-9-7-6-8-10-18;/h6-12,15,24H,13-14,16H2,1-5H3;1H |
| InChIKey | PVTOXLIIKUMOHJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|