C27H29BrN2O2 — CID 122187876
2-(5-bromo-2-methyl-1H-indol-3-yl)-N,N-bis[(4-methoxyphenyl)methyl]ethanamine (PubChem CID 122187876) has the molecular formula C27H29BrN2O2 and a molecular weight of 493.45 g/mol. Its IUPAC name is 2-(5-bromo-2-methyl-1H-indol-3-yl)-N,N-bis[(4-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-(5-bromo-2-methyl-1H-indol-3-yl)-N,N-bis[(4-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 122187876 |
| Molecular Formula | C27H29BrN2O2 |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-(5-bromo-2-methyl-1H-indol-3-yl)-N,N-bis[(4-methoxyphenyl)methyl]ethanamine |
| SMILES | COc1ccc(CN(CCc2c(C)[nH]c3ccc(Br)cc23)Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H29BrN2O2/c1-19-25(26-16-22(28)8-13-27(26)29-19)14-15-30(17-20-4-9-23(31-2)10-5-20)18-21-6-11-24(32-3)12-7-21/h4-13,16,29H,14-15,17-18H2,1-3H3 |
| InChIKey | PKMDOLVWHVJCDU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|