C19H20BrN3OS — CID 4189889
1-[2-(5-bromo-2-methyl-1H-indol-3-yl)ethyl]-3-(2-methoxyphenyl)thiourea (PubChem CID 4189889) has the molecular formula C19H20BrN3OS and a molecular weight of 418.36 g/mol. Its IUPAC name is 1-[2-(5-bromo-2-methyl-1H-indol-3-yl)ethyl]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[2-(5-bromo-2-methyl-1H-indol-3-yl)ethyl]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 4189889 |
| Molecular Formula | C19H20BrN3OS |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 1-[2-(5-bromo-2-methyl-1H-indol-3-yl)ethyl]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)NCCc1c(C)[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C19H20BrN3OS/c1-12-14(15-11-13(20)7-8-16(15)22-12)9-10-21-19(25)23-17-5-3-4-6-18(17)24-2/h3-8,11,22H,9-10H2,1-2H3,(H2,21,23,25) |
| InChIKey | ZHUSKZQUBWDSMS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 49.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|