C23H29N3O2 — CID 10293116
4-amino-N-benzyl-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]butanamide (PubChem CID 10293116) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-amino-N-benzyl-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]butanamide.
| Compound Name | 4-amino-N-benzyl-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 10293116 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 4-amino-N-benzyl-N-[2-(5-methoxy-2-methyl-1H-indol-3-yl)ethyl]butanamide |
| SMILES | COc1ccc2[nH]c(C)c(CCN(Cc3ccccc3)C(=O)CCCN)c2c1 |
| InChI | InChI=1S/C23H29N3O2/c1-17-20(21-15-19(28-2)10-11-22(21)25-17)12-14-26(23(27)9-6-13-24)16-18-7-4-3-5-8-18/h3-5,7-8,10-11,15,25H,6,9,12-14,16,24H2,1-2H3 |
| InChIKey | NOSKRLZOYYAOTQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|