C20H18F3NO4 — CID 142110849
2-[2-[[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]methyl]phenoxy]propanoic acid (PubChem CID 142110849) has the molecular formula C20H18F3NO4 and a molecular weight of 393.36 g/mol. Its IUPAC name is 2-[2-[[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]methyl]phenoxy]propanoic acid.
| Compound Name | 2-[2-[[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 142110849 |
| Molecular Formula | C20H18F3NO4 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[2-[[2-methyl-5-(trifluoromethoxy)-1H-indol-3-yl]methyl]phenoxy]propanoic acid |
| SMILES | Cc1[nH]c2ccc(OC(F)(F)F)cc2c1Cc1ccccc1OC(C)C(=O)O |
| InChI | InChI=1S/C20H18F3NO4/c1-11-15(9-13-5-3-4-6-18(13)27-12(2)19(25)26)16-10-14(28-20(21,22)23)7-8-17(16)24-11/h3-8,10,12,24H,9H2,1-2H3,(H,25,26) |
| InChIKey | LCYNEWSTEJFEQB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|