C21H20F3NO4 — CID 78018818
2-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]propanoic acid (PubChem CID 78018818) has the molecular formula C21H20F3NO4 and a molecular weight of 407.39 g/mol. Its IUPAC name is 2-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]propanoic acid.
| Compound Name | 2-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 78018818 |
| Molecular Formula | C21H20F3NO4 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]propanoic acid |
| SMILES | Cc1c(Cc2cccc(OC(C)C(=O)O)c2)c2cc(OC(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C21H20F3NO4/c1-12-17(10-14-5-4-6-15(9-14)28-13(2)20(26)27)18-11-16(29-21(22,23)24)7-8-19(18)25(12)3/h4-9,11,13H,10H2,1-3H3,(H,26,27) |
| InChIKey | ZTLOQNOLJLGCLD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|