C17H16F3NO4 — CID 142113374
2-[4-[[3-(trifluoromethoxy)phenyl]methylamino]phenoxy]propanoic acid (PubChem CID 142113374) has the molecular formula C17H16F3NO4 and a molecular weight of 355.31 g/mol. Its IUPAC name is 2-[4-[[3-(trifluoromethoxy)phenyl]methylamino]phenoxy]propanoic acid.
| Compound Name | 2-[4-[[3-(trifluoromethoxy)phenyl]methylamino]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 142113374 |
| Molecular Formula | C17H16F3NO4 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-[4-[[3-(trifluoromethoxy)phenyl]methylamino]phenoxy]propanoic acid |
| SMILES | CC(Oc1ccc(NCc2cccc(OC(F)(F)F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C17H16F3NO4/c1-11(16(22)23)24-14-7-5-13(6-8-14)21-10-12-3-2-4-15(9-12)25-17(18,19)20/h2-9,11,21H,10H2,1H3,(H,22,23) |
| InChIKey | YPFCRGVNZKWSLS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|