C33H36F3NO4 — CID 142110828
(5E)-3,4-bis(ethenyl)hepta-1,3,5-triene;2-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]-2-methylpropanoic acid (PubChem CID 142110828) has the molecular formula C33H36F3NO4 and a molecular weight of 567.65 g/mol. Its IUPAC name is (5E)-3,4-bis(ethenyl)hepta-1,3,5-triene;2-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | (5E)-3,4-bis(ethenyl)hepta-1,3,5-triene;2-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 142110828 |
| Molecular Formula | C33H36F3NO4 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | (5E)-3,4-bis(ethenyl)hepta-1,3,5-triene;2-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]-2-methylpropanoic acid |
| SMILES | C=CC(C=C)=C(C=C)/C=C/C.Cc1c(Cc2cccc(OC(C)(C)C(=O)O)c2)c2cc(OC(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C22H22F3NO4.C11H14/c1-13-17(11-14-6-5-7-15(10-14)29-21(2,3)20(27)28)18-12-16(30-22(23,24)25)8-9-19(18)26(13)4;1-5-9-11(8-4)10(6-2)7-3/h5-10,12H,11H2,1-4H3,(H,27,28);5-9H,2-4H2,1H3/b;9-5+ |
| InChIKey | PZMGSGGVGZOGQK-DTDKZNDQSA-N |
| XLogP | 8.64 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|