C25H27NO5 — CID 142110832
2-[4-[[1-[(E)-but-2-enoyl]-5-methoxy-2-methylindol-3-yl]methyl]phenoxy]-2-methylpropanoic acid (PubChem CID 142110832) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 2-[4-[[1-[(E)-but-2-enoyl]-5-methoxy-2-methylindol-3-yl]methyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[[1-[(E)-but-2-enoyl]-5-methoxy-2-methylindol-3-yl]methyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 142110832 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-[4-[[1-[(E)-but-2-enoyl]-5-methoxy-2-methylindol-3-yl]methyl]phenoxy]-2-methylpropanoic acid |
| SMILES | C/C=C/C(=O)n1c(C)c(Cc2ccc(OC(C)(C)C(=O)O)cc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C25H27NO5/c1-6-7-23(27)26-16(2)20(21-15-19(30-5)12-13-22(21)26)14-17-8-10-18(11-9-17)31-25(3,4)24(28)29/h6-13,15H,14H2,1-5H3,(H,28,29)/b7-6+ |
| InChIKey | PJUXPGSRZHKWOQ-VOTSOKGWSA-N |
| XLogP | 5.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|