C23H26N2O6S — CID 172685117
ethanesulfonic acid;2-[5-methoxy-2-methyl-1-[(E)-3-phenylprop-2-enoyl]indol-3-yl]acetamide (PubChem CID 172685117) has the molecular formula C23H26N2O6S and a molecular weight of 458.54 g/mol. Its IUPAC name is ethanesulfonic acid;2-[5-methoxy-2-methyl-1-[(E)-3-phenylprop-2-enoyl]indol-3-yl]acetamide.
| Compound Name | ethanesulfonic acid;2-[5-methoxy-2-methyl-1-[(E)-3-phenylprop-2-enoyl]indol-3-yl]acetamide |
|---|---|
| PubChem CID | 172685117 |
| Molecular Formula | C23H26N2O6S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | ethanesulfonic acid;2-[5-methoxy-2-methyl-1-[(E)-3-phenylprop-2-enoyl]indol-3-yl]acetamide |
| SMILES | CCS(=O)(=O)O.COc1ccc2c(c1)c(CC(N)=O)c(C)n2C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H20N2O3.C2H6O3S/c1-14-17(13-20(22)24)18-12-16(26-2)9-10-19(18)23(14)21(25)11-8-15-6-4-3-5-7-15;1-2-6(3,4)5/h3-12H,13H2,1-2H3,(H2,22,24);2H2,1H3,(H,3,4,5)/b11-8+; |
| InChIKey | AXVSAYPVNDLFOI-YGCVIUNWSA-N |
| XLogP | 3.23 |
| TPSA | 128.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|