C20H19NO2 — CID 142885299
(E)-1-(5-methoxy-2,3-dimethylindol-1-yl)-3-phenylprop-2-en-1-one (PubChem CID 142885299) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (E)-1-(5-methoxy-2,3-dimethylindol-1-yl)-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-(5-methoxy-2,3-dimethylindol-1-yl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 142885299 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (E)-1-(5-methoxy-2,3-dimethylindol-1-yl)-3-phenylprop-2-en-1-one |
| SMILES | COc1ccc2c(c1)c(C)c(C)n2C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H19NO2/c1-14-15(2)21(19-11-10-17(23-3)13-18(14)19)20(22)12-9-16-7-5-4-6-8-16/h4-13H,1-3H3/b12-9+ |
| InChIKey | LRGMKNFUENWVJM-FMIVXFBMSA-N |
| XLogP | 4.62 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|