C22H24ClNO4 — CID 143547415
(E)-4-chlorohex-4-en-1-yne;2-[5-methoxy-2-methyl-1-(2-methylprop-2-enoyl)indol-3-yl]acetic acid (PubChem CID 143547415) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is (E)-4-chlorohex-4-en-1-yne;2-[5-methoxy-2-methyl-1-(2-methylprop-2-enoyl)indol-3-yl]acetic acid.
| Compound Name | (E)-4-chlorohex-4-en-1-yne;2-[5-methoxy-2-methyl-1-(2-methylprop-2-enoyl)indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 143547415 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (E)-4-chlorohex-4-en-1-yne;2-[5-methoxy-2-methyl-1-(2-methylprop-2-enoyl)indol-3-yl]acetic acid |
| SMILES | C#CC/C(Cl)=C\C.C=C(C)C(=O)n1c(C)c(CC(=O)O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C16H17NO4.C6H7Cl/c1-9(2)16(20)17-10(3)12(8-15(18)19)13-7-11(21-4)5-6-14(13)17;1-3-5-6(7)4-2/h5-7H,1,8H2,2-4H3,(H,18,19);1,4H,5H2,2H3/b;6-4+ |
| InChIKey | AXADKZSBUYNLMS-DVXCEAISSA-N |
| XLogP | 4.95 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|