C31H36F3NO6 — CID 142110872
2-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]propanoic acid;(2E,4E,6Z)-5-methoxynona-2,4,6-trien-1-ol (PubChem CID 142110872) has the molecular formula C31H36F3NO6 and a molecular weight of 575.62 g/mol. Its IUPAC name is 2-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]propanoic acid;(2E,4E,6Z)-5-methoxynona-2,4,6-trien-1-ol.
| Compound Name | 2-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]propanoic acid;(2E,4E,6Z)-5-methoxynona-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 142110872 |
| Molecular Formula | C31H36F3NO6 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | 2-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]propanoic acid;(2E,4E,6Z)-5-methoxynona-2,4,6-trien-1-ol |
| SMILES | CC/C=C\C(=C/C=C/CO)OC.Cc1c(Cc2cccc(OC(C)C(=O)O)c2)c2cc(OC(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C21H20F3NO4.C10H16O2/c1-12-17(10-14-5-4-6-15(9-14)28-13(2)20(26)27)18-11-16(29-21(22,23)24)7-8-19(18)25(12)3;1-3-4-7-10(12-2)8-5-6-9-11/h4-9,11,13H,10H2,1-3H3,(H,26,27);4-8,11H,3,9H2,1-2H3/b;6-5+,7-4-,10-8+ |
| InChIKey | RNYAHNJYCJALDX-KRTRXZKQSA-N |
| XLogP | 6.86 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|