C30H33ClF3NO5 — CID 142868873
(2R)-2-[3-[3-[(3Z)-5-chloro-2-methylidenehexa-3,5-dienoyl]-2-methyl-6-(trifluoromethoxy)indol-1-yl]phenoxy]propanoic acid;ethane (PubChem CID 142868873) has the molecular formula C30H33ClF3NO5 and a molecular weight of 580.04 g/mol. Its IUPAC name is (2R)-2-[3-[3-[(3Z)-5-chloro-2-methylidenehexa-3,5-dienoyl]-2-methyl-6-(trifluoromethoxy)indol-1-yl]phenoxy]propanoic acid;ethane.
| Compound Name | (2R)-2-[3-[3-[(3Z)-5-chloro-2-methylidenehexa-3,5-dienoyl]-2-methyl-6-(trifluoromethoxy)indol-1-yl]phenoxy]propanoic acid;ethane |
|---|---|
| PubChem CID | 142868873 |
| Molecular Formula | C30H33ClF3NO5 |
| Molecular Weight | 580.04 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | (2R)-2-[3-[3-[(3Z)-5-chloro-2-methylidenehexa-3,5-dienoyl]-2-methyl-6-(trifluoromethoxy)indol-1-yl]phenoxy]propanoic acid;ethane |
| SMILES | C=C(Cl)/C=C\C(=C)C(=O)c1c(C)n(-c2cccc(O[C@H](C)C(=O)O)c2)c2cc(OC(F)(F)F)ccc12.CC.CC |
| InChI | InChI=1S/C26H21ClF3NO5.2C2H6/c1-14(8-9-15(2)27)24(32)23-16(3)31(18-6-5-7-19(12-18)35-17(4)25(33)34)22-13-20(10-11-21(22)23)36-26(28,29)30;2*1-2/h5-13,17H,1-2H2,3-4H3,(H,33,34);2*1-2H3/b9-8-;;/t17-;;/m1../s1 |
| InChIKey | JSPJWBNRRMVHGN-VXWMMWJDSA-N |
| XLogP | 8.79 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.04 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|