C30H34ClF4NO5 — CID 142868869
(E)-2-chloropent-2-ene;(2S)-2-[2-fluoro-5-[3-formyl-2-methyl-6-(trifluoromethoxy)indol-1-yl]phenoxy]propanoic acid;2-methylbut-2-ene (PubChem CID 142868869) has the molecular formula C30H34ClF4NO5 and a molecular weight of 600.05 g/mol. Its IUPAC name is (E)-2-chloropent-2-ene;(2S)-2-[2-fluoro-5-[3-formyl-2-methyl-6-(trifluoromethoxy)indol-1-yl]phenoxy]propanoic acid;2-methylbut-2-ene.
| Compound Name | (E)-2-chloropent-2-ene;(2S)-2-[2-fluoro-5-[3-formyl-2-methyl-6-(trifluoromethoxy)indol-1-yl]phenoxy]propanoic acid;2-methylbut-2-ene |
|---|---|
| PubChem CID | 142868869 |
| Molecular Formula | C30H34ClF4NO5 |
| Molecular Weight | 600.05 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | (E)-2-chloropent-2-ene;(2S)-2-[2-fluoro-5-[3-formyl-2-methyl-6-(trifluoromethoxy)indol-1-yl]phenoxy]propanoic acid;2-methylbut-2-ene |
| SMILES | CC/C=C(\C)Cl.CC=C(C)C.Cc1c(C=O)c2ccc(OC(F)(F)F)cc2n1-c1ccc(F)c(O[C@@H](C)C(=O)O)c1 |
| InChI | InChI=1S/C20H15F4NO5.C5H9Cl.C5H10/c1-10-15(9-26)14-5-4-13(30-20(22,23)24)8-17(14)25(10)12-3-6-16(21)18(7-12)29-11(2)19(27)28;1-3-4-5(2)6;1-4-5(2)3/h3-9,11H,1-2H3,(H,27,28);4H,3H2,1-2H3;4H,1-3H3/b;5-4+;/t11-;;/m0../s1 |
| InChIKey | IJNOMGJVZNZJBF-IBBGERCJSA-N |
| XLogP | 9.15 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.05 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|