C12H13F3N2O — CID 125479327
[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methanamine (PubChem CID 125479327) has the molecular formula C12H13F3N2O and a molecular weight of 258.24 g/mol. Its IUPAC name is [1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methanamine.
| Compound Name | [1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methanamine |
|---|---|
| PubChem CID | 125479327 |
| Molecular Formula | C12H13F3N2O |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | [1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methanamine |
| SMILES | Cc1c(CN)c2cc(OC(F)(F)F)ccc2n1C |
| InChI | InChI=1S/C12H13F3N2O/c1-7-10(6-16)9-5-8(18-12(13,14)15)3-4-11(9)17(7)2/h3-5H,6,16H2,1-2H3 |
| InChIKey | REYRZIJVDIITMS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|