C23H24F3NO4 — CID 71165173
3-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenyl]-2-ethoxypropanoic acid (PubChem CID 71165173) has the molecular formula C23H24F3NO4 and a molecular weight of 435.44 g/mol. Its IUPAC name is 3-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 71165173 |
| Molecular Formula | C23H24F3NO4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-[3-[[1,2-dimethyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1cccc(Cc2c(C)n(C)c3ccc(OC(F)(F)F)cc23)c1)C(=O)O |
| InChI | InChI=1S/C23H24F3NO4/c1-4-30-21(22(28)29)12-16-7-5-6-15(10-16)11-18-14(2)27(3)20-9-8-17(13-19(18)20)31-23(24,25)26/h5-10,13,21H,4,11-12H2,1-3H3,(H,28,29) |
| InChIKey | NAXZJIMLVJYGLB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|