C12H10F3NO2 — CID 123620380
4-methyl-2-[[3-(trifluoromethoxy)phenyl]methyl]-1,3-oxazole (PubChem CID 123620380) has the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. Its IUPAC name is 4-methyl-2-[[3-(trifluoromethoxy)phenyl]methyl]-1,3-oxazole.
| Compound Name | 4-methyl-2-[[3-(trifluoromethoxy)phenyl]methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 123620380 |
| Molecular Formula | C12H10F3NO2 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-methyl-2-[[3-(trifluoromethoxy)phenyl]methyl]-1,3-oxazole |
| SMILES | Cc1coc(Cc2cccc(OC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C12H10F3NO2/c1-8-7-17-11(16-8)6-9-3-2-4-10(5-9)18-12(13,14)15/h2-5,7H,6H2,1H3 |
| InChIKey | SSXZOLQPPFBNRC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |