C20H20ClNO2 — CID 69096840
3-[(2-tert-butyl-6-chloro-1H-indol-3-yl)methyl]benzoic acid (PubChem CID 69096840) has the molecular formula C20H20ClNO2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 3-[(2-tert-butyl-6-chloro-1H-indol-3-yl)methyl]benzoic acid.
| Compound Name | 3-[(2-tert-butyl-6-chloro-1H-indol-3-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 69096840 |
| Molecular Formula | C20H20ClNO2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3-[(2-tert-butyl-6-chloro-1H-indol-3-yl)methyl]benzoic acid |
| SMILES | CC(C)(C)c1[nH]c2cc(Cl)ccc2c1Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C20H20ClNO2/c1-20(2,3)18-16(15-8-7-14(21)11-17(15)22-18)10-12-5-4-6-13(9-12)19(23)24/h4-9,11,22H,10H2,1-3H3,(H,23,24) |
| InChIKey | FWTKIZNFQANIDJ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |