C25H17ClN2O2 — CID 122515929
3-[(Z)-2-(2-benzyl-6-chloro-1H-indol-3-yl)-1-cyanoethenyl]benzoic acid (PubChem CID 122515929) has the molecular formula C25H17ClN2O2 and a molecular weight of 412.88 g/mol. Its IUPAC name is 3-[(Z)-2-(2-benzyl-6-chloro-1H-indol-3-yl)-1-cyanoethenyl]benzoic acid.
| Compound Name | 3-[(Z)-2-(2-benzyl-6-chloro-1H-indol-3-yl)-1-cyanoethenyl]benzoic acid |
|---|---|
| PubChem CID | 122515929 |
| Molecular Formula | C25H17ClN2O2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 3-[(Z)-2-(2-benzyl-6-chloro-1H-indol-3-yl)-1-cyanoethenyl]benzoic acid |
| SMILES | N#C/C(=C\c1c(Cc2ccccc2)[nH]c2cc(Cl)ccc12)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H17ClN2O2/c26-20-9-10-21-22(13-19(15-27)17-7-4-8-18(12-17)25(29)30)23(28-24(21)14-20)11-16-5-2-1-3-6-16/h1-10,12-14,28H,11H2,(H,29,30)/b19-13+ |
| InChIKey | NPRNUZXMUWUIFA-CPNJWEJPSA-N |
| XLogP | 6.17 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|