C23H15Cl2NO3 — CID 3555032
4-[1-cyano-2-[2-[(2,4-dichlorophenyl)methoxy]phenyl]ethenyl]benzoic acid (PubChem CID 3555032) has the molecular formula C23H15Cl2NO3 and a molecular weight of 424.28 g/mol. Its IUPAC name is 4-[1-cyano-2-[2-[(2,4-dichlorophenyl)methoxy]phenyl]ethenyl]benzoic acid.
| Compound Name | 4-[1-cyano-2-[2-[(2,4-dichlorophenyl)methoxy]phenyl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 3555032 |
| Molecular Formula | C23H15Cl2NO3 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 4-[1-cyano-2-[2-[(2,4-dichlorophenyl)methoxy]phenyl]ethenyl]benzoic acid |
| SMILES | N#CC(=Cc1ccccc1OCc1ccc(Cl)cc1Cl)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H15Cl2NO3/c24-20-10-9-18(21(25)12-20)14-29-22-4-2-1-3-17(22)11-19(13-26)15-5-7-16(8-6-15)23(27)28/h1-12H,14H2,(H,27,28) |
| InChIKey | BVBJZBAZVQGBTL-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|