C19H16F4N2O3 — CID 143038233
2-[4-fluoro-5-hydroxy-2-methyl-1-[[4-(trifluoromethylamino)phenyl]methyl]indol-3-yl]acetic acid (PubChem CID 143038233) has the molecular formula C19H16F4N2O3 and a molecular weight of 396.34 g/mol. Its IUPAC name is 2-[4-fluoro-5-hydroxy-2-methyl-1-[[4-(trifluoromethylamino)phenyl]methyl]indol-3-yl]acetic acid.
| Compound Name | 2-[4-fluoro-5-hydroxy-2-methyl-1-[[4-(trifluoromethylamino)phenyl]methyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 143038233 |
| Molecular Formula | C19H16F4N2O3 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-[4-fluoro-5-hydroxy-2-methyl-1-[[4-(trifluoromethylamino)phenyl]methyl]indol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2c(F)c(O)ccc2n1Cc1ccc(NC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F4N2O3/c1-10-13(8-16(27)28)17-14(6-7-15(26)18(17)20)25(10)9-11-2-4-12(5-3-11)24-19(21,22)23/h2-7,24,26H,8-9H2,1H3,(H,27,28) |
| InChIKey | QEWPXLKLMKLDDG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|