C20H24FNO4S — CID 143414474
ethane;2-[1-[(Z)-2-ethenylsulfanylpent-2-enoyl]-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetic acid (PubChem CID 143414474) has the molecular formula C20H24FNO4S and a molecular weight of 393.48 g/mol. Its IUPAC name is ethane;2-[1-[(Z)-2-ethenylsulfanylpent-2-enoyl]-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetic acid.
| Compound Name | ethane;2-[1-[(Z)-2-ethenylsulfanylpent-2-enoyl]-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 143414474 |
| Molecular Formula | C20H24FNO4S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | ethane;2-[1-[(Z)-2-ethenylsulfanylpent-2-enoyl]-4-fluoro-5-hydroxy-2-methylindol-3-yl]acetic acid |
| SMILES | C=CS/C(=C\CC)C(=O)n1c(C)c(CC(=O)O)c2c(F)c(O)ccc21.CC |
| InChI | InChI=1S/C18H18FNO4S.C2H6/c1-4-6-14(25-5-2)18(24)20-10(3)11(9-15(22)23)16-12(20)7-8-13(21)17(16)19;1-2/h5-8,21H,2,4,9H2,1,3H3,(H,22,23);1-2H3/b14-6-; |
| InChIKey | SODKJFUKQZUSIO-WQMRFYCQSA-N |
| XLogP | 5.26 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|