C18H16FNO4S — CID 67244452
2-[4-fluoro-5-methoxy-2-methyl-1-(5-methylthiophene-2-carbonyl)indol-3-yl]acetic acid (PubChem CID 67244452) has the molecular formula C18H16FNO4S and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-[4-fluoro-5-methoxy-2-methyl-1-(5-methylthiophene-2-carbonyl)indol-3-yl]acetic acid.
| Compound Name | 2-[4-fluoro-5-methoxy-2-methyl-1-(5-methylthiophene-2-carbonyl)indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 67244452 |
| Molecular Formula | C18H16FNO4S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-[4-fluoro-5-methoxy-2-methyl-1-(5-methylthiophene-2-carbonyl)indol-3-yl]acetic acid |
| SMILES | COc1ccc2c(c1F)c(CC(=O)O)c(C)n2C(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C18H16FNO4S/c1-9-4-7-14(25-9)18(23)20-10(2)11(8-15(21)22)16-12(20)5-6-13(24-3)17(16)19/h4-7H,8H2,1-3H3,(H,21,22) |
| InChIKey | RUXOJOWVZDDRDM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |