C19H13ClF5NO5S — CID 87322591
2-[4-chloro-5-methoxy-2-methyl-1-[5-(1,1,2,2,2-pentafluoroethoxy)thiophene-2-carbonyl]indol-3-yl]acetic acid (PubChem CID 87322591) has the molecular formula C19H13ClF5NO5S and a molecular weight of 497.83 g/mol. Its IUPAC name is 2-[4-chloro-5-methoxy-2-methyl-1-[5-(1,1,2,2,2-pentafluoroethoxy)thiophene-2-carbonyl]indol-3-yl]acetic acid.
| Compound Name | 2-[4-chloro-5-methoxy-2-methyl-1-[5-(1,1,2,2,2-pentafluoroethoxy)thiophene-2-carbonyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 87322591 |
| Molecular Formula | C19H13ClF5NO5S |
| Molecular Weight | 497.83 g/mol |
| Exact Mass | 497.01 |
| IUPAC Name | 2-[4-chloro-5-methoxy-2-methyl-1-[5-(1,1,2,2,2-pentafluoroethoxy)thiophene-2-carbonyl]indol-3-yl]acetic acid |
| SMILES | COc1ccc2c(c1Cl)c(CC(=O)O)c(C)n2C(=O)c1ccc(OC(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C19H13ClF5NO5S/c1-8-9(7-13(27)28)15-10(3-4-11(30-2)16(15)20)26(8)17(29)12-5-6-14(32-12)31-19(24,25)18(21,22)23/h3-6H,7H2,1-2H3,(H,27,28) |
| InChIKey | JOGGILSRQKVUHD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.83 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|